C17H22N4O2 — CID 56902169
[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methanol (PubChem CID 56902169) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is [4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methanol.
| Compound Name | [4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methanol |
|---|---|
| PubChem CID | 56902169 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methanol |
| SMILES | OCc1ccc2c(c1)CN(Cc1cc3n(n1)CCNC3)CCO2 |
| InChI | InChI=1S/C17H22N4O2/c22-12-13-1-2-17-14(7-13)10-20(5-6-23-17)11-15-8-16-9-18-3-4-21(16)19-15/h1-2,7-8,18,22H,3-6,9-12H2 |
| InChIKey | QQULPURTOFGBPF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |