About 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine
2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine (PubChem CID 83694497) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine.
Analyze 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine?
The IUPAC name of 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine (CID 83694497) is 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine?
The canonical SMILES for 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine is CCc1cc2n(n1)CCNC2.
What is the InChIKey of 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine?
The InChIKey is QISUAQWXVKNDCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-2-7-5-8-6-9-3-4-11(8)10-7/h5,9H,2-4,6H2,1H3.
What are the key properties of 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine?
2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine has a molecular weight of 151.21 g/mol, XLogP of 0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 83694497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).