C18H21FN4O3 — CID 56903187
2-[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 56903187) has the molecular formula C18H21FN4O3 and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 2-[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 56903187 |
| Molecular Formula | C18H21FN4O3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | O=C1NC(=O)C2(CC(C(=O)N3CCN(Cc4cccc(F)c4)CC3)C2)N1 |
| InChI | InChI=1S/C18H21FN4O3/c19-14-3-1-2-12(8-14)11-22-4-6-23(7-5-22)15(24)13-9-18(10-13)16(25)20-17(26)21-18/h1-3,8,13H,4-7,9-11H2,(H2,20,21,25,26) |
| InChIKey | TWKFBKSBSCXBEV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|