C19H34N2O — CID 56903234
9-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-oxa-9-azaspiro[5.5]undecane (PubChem CID 56903234) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is 9-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-oxa-9-azaspiro[5.5]undecane.
| Compound Name | 9-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-oxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 56903234 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 9-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-oxa-9-azaspiro[5.5]undecane |
| SMILES | C1CCN2CCC[C@@H](CN3CCC4(CCOCC4)CC3)[C@H]2C1 |
| InChI | InChI=1S/C19H34N2O/c1-2-10-21-11-3-4-17(18(21)5-1)16-20-12-6-19(7-13-20)8-14-22-15-9-19/h17-18H,1-16H2/t17-,18+/m0/s1 |
| InChIKey | MZLPPYMWYMXWOY-ZWKOTPCHSA-N |
| XLogP | 3.14 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |