C19H27N5O2 — CID 56903348
2-[4-(2-aminopyrimidin-4-yl)-1-[(2-ethoxyphenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 56903348) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-[4-(2-aminopyrimidin-4-yl)-1-[(2-ethoxyphenyl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[4-(2-aminopyrimidin-4-yl)-1-[(2-ethoxyphenyl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 56903348 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 2-[4-(2-aminopyrimidin-4-yl)-1-[(2-ethoxyphenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | CCOc1ccccc1CN1CCN(c2ccnc(N)n2)CC1CCO |
| InChI | InChI=1S/C19H27N5O2/c1-2-26-17-6-4-3-5-15(17)13-23-10-11-24(14-16(23)8-12-25)18-7-9-21-19(20)22-18/h3-7,9,16,25H,2,8,10-14H2,1H3,(H2,20,21,22) |
| InChIKey | UYSIBZLXMQFMER-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |