C20H26ClN3O2 — CID 95861594
2-[(2S)-4-(3-chloro-2-pyridinyl)-1-[(2-ethoxyphenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 95861594) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 2-[(2S)-4-(3-chloro-2-pyridinyl)-1-[(2-ethoxyphenyl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-(3-chloro-2-pyridinyl)-1-[(2-ethoxyphenyl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 95861594 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-[(2S)-4-(3-chloro-2-pyridinyl)-1-[(2-ethoxyphenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | CCOc1ccccc1CN1CCN(c2ncccc2Cl)C[C@@H]1CCO |
| InChI | InChI=1S/C20H26ClN3O2/c1-2-26-19-8-4-3-6-16(19)14-23-11-12-24(15-17(23)9-13-25)20-18(21)7-5-10-22-20/h3-8,10,17,25H,2,9,11-15H2,1H3/t17-/m0/s1 |
| InChIKey | GQIOIYUBYKORHD-KRWDZBQOSA-N |
| XLogP | 3.21 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |