C19H26N4O3 — CID 56905821
2-(3-hydroxypiperidin-1-yl)-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylacetamide (PubChem CID 56905821) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-(3-hydroxypiperidin-1-yl)-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylacetamide.
| Compound Name | 2-(3-hydroxypiperidin-1-yl)-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 56905821 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-(3-hydroxypiperidin-1-yl)-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylacetamide |
| SMILES | COc1cccc(-n2cc(CN(C)C(=O)CN3CCCC(O)C3)cn2)c1 |
| InChI | InChI=1S/C19H26N4O3/c1-21(19(25)14-22-8-4-6-17(24)13-22)11-15-10-20-23(12-15)16-5-3-7-18(9-16)26-2/h3,5,7,9-10,12,17,24H,4,6,8,11,13-14H2,1-2H3 |
| InChIKey | PXXCEEFMURCZRM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |