C17H19N5O4 — CID 95897893
2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylacetamide (PubChem CID 95897893) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylacetamide.
| Compound Name | 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 95897893 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-N-methylacetamide |
| SMILES | COc1cccc(-n2cc(CN(C)C(=O)C[C@H]3NC(=O)NC3=O)cn2)c1 |
| InChI | InChI=1S/C17H19N5O4/c1-21(15(23)7-14-16(24)20-17(25)19-14)9-11-8-18-22(10-11)12-4-3-5-13(6-12)26-2/h3-6,8,10,14H,7,9H2,1-2H3,(H2,19,20,24,25)/t14-/m1/s1 |
| InChIKey | XIVOERJLLJOLHN-CQSZACIVSA-N |
| XLogP | 0.44 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|