C18H26N4O3 — CID 56906487
2-methyl-5-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]-1H-pyrimidin-6-one (PubChem CID 56906487) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-methyl-5-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-5-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 56906487 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-methyl-5-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]-1H-pyrimidin-6-one |
| SMILES | Cc1ncc(CC(=O)N2CCC(C(=O)N3CCCCC3)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H26N4O3/c1-13-19-12-15(17(24)20-13)11-16(23)21-9-5-14(6-10-21)18(25)22-7-3-2-4-8-22/h12,14H,2-11H2,1H3,(H,19,20,24) |
| InChIKey | BKEVOFVQSSPTDU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |