C15H24N4O4S — CID 56911567
ethyl 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate (PubChem CID 56911567) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is ethyl 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate.
| Compound Name | ethyl 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
|---|---|
| PubChem CID | 56911567 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | ethyl 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
| SMILES | CCOC(=O)N1CCCn2nc(CN3CCS(=O)(=O)CC3)cc2C1 |
| InChI | InChI=1S/C15H24N4O4S/c1-2-23-15(20)18-4-3-5-19-14(12-18)10-13(16-19)11-17-6-8-24(21,22)9-7-17/h10H,2-9,11-12H2,1H3 |
| InChIKey | RADSTGHUDFAZOF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |