C19H28N2O4 — CID 56912537
(4aS,8aR)-6-[3-(furan-2-yl)propanoyl]-1-(3-methoxypropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56912537) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is (4aS,8aR)-6-[3-(furan-2-yl)propanoyl]-1-(3-methoxypropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-[3-(furan-2-yl)propanoyl]-1-(3-methoxypropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56912537 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (4aS,8aR)-6-[3-(furan-2-yl)propanoyl]-1-(3-methoxypropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COCCCN1C(=O)CC[C@H]2CN(C(=O)CCc3ccco3)CC[C@H]21 |
| InChI | InChI=1S/C19H28N2O4/c1-24-12-3-10-21-17-9-11-20(14-15(17)5-7-19(21)23)18(22)8-6-16-4-2-13-25-16/h2,4,13,15,17H,3,5-12,14H2,1H3/t15-,17+/m0/s1 |
| InChIKey | GNRXFIDRZOZPTF-DOTOQJQBSA-N |
| XLogP | 2.09 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|