C21H30N2O4 — CID 70734634
(4aS,8aR)-1-(4-hydroxybutyl)-6-[3-(4-hydroxyphenyl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70734634) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is (4aS,8aR)-1-(4-hydroxybutyl)-6-[3-(4-hydroxyphenyl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(4-hydroxybutyl)-6-[3-(4-hydroxyphenyl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70734634 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (4aS,8aR)-1-(4-hydroxybutyl)-6-[3-(4-hydroxyphenyl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C(CCc1ccc(O)cc1)N1CC[C@@H]2[C@@H](CCC(=O)N2CCCCO)C1 |
| InChI | InChI=1S/C21H30N2O4/c24-14-2-1-12-23-19-11-13-22(15-17(19)6-10-21(23)27)20(26)9-5-16-3-7-18(25)8-4-16/h3-4,7-8,17,19,24-25H,1-2,5-6,9-15H2/t17-,19+/m0/s1 |
| InChIKey | FXCDOZKAMYXANS-PKOBYXMFSA-N |
| XLogP | 1.94 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|