C21H28N2O3 — CID 56903468
(4aS,8aR)-1-(3-hydroxypropyl)-6-(1-phenylcyclopropanecarbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56903468) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-hydroxypropyl)-6-(1-phenylcyclopropanecarbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-hydroxypropyl)-6-(1-phenylcyclopropanecarbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56903468 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (4aS,8aR)-1-(3-hydroxypropyl)-6-(1-phenylcyclopropanecarbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@H]2CN(C(=O)C3(c4ccccc4)CC3)CC[C@H]2N1CCCO |
| InChI | InChI=1S/C21H28N2O3/c24-14-4-12-23-18-9-13-22(15-16(18)7-8-19(23)25)20(26)21(10-11-21)17-5-2-1-3-6-17/h1-3,5-6,16,18,24H,4,7-15H2/t16-,18+/m0/s1 |
| InChIKey | OFSYMTQRMNLOHW-FUHWJXTLSA-N |
| XLogP | 1.94 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |