C18H31N3O2 — CID 56915608
(4aS,8aR)-1-(2-aminoethyl)-6-(1-methylcyclohexanecarbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56915608) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is (4aS,8aR)-1-(2-aminoethyl)-6-(1-methylcyclohexanecarbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(2-aminoethyl)-6-(1-methylcyclohexanecarbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56915608 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | (4aS,8aR)-1-(2-aminoethyl)-6-(1-methylcyclohexanecarbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CC1(C(=O)N2CC[C@@H]3[C@@H](CCC(=O)N3CCN)C2)CCCCC1 |
| InChI | InChI=1S/C18H31N3O2/c1-18(8-3-2-4-9-18)17(23)20-11-7-15-14(13-20)5-6-16(22)21(15)12-10-19/h14-15H,2-13,19H2,1H3/t14-,15+/m0/s1 |
| InChIKey | WTSOYVKMKBSTGA-LSDHHAIUSA-N |
| XLogP | 1.75 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |