C16H22N2O3S — CID 56911999
(4aS,8aR)-1-(3-hydroxypropyl)-6-(thiophene-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56911999) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-hydroxypropyl)-6-(thiophene-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-hydroxypropyl)-6-(thiophene-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56911999 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (4aS,8aR)-1-(3-hydroxypropyl)-6-(thiophene-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C(c1ccsc1)N1CC[C@@H]2[C@@H](CCC(=O)N2CCCO)C1 |
| InChI | InChI=1S/C16H22N2O3S/c19-8-1-6-18-14-4-7-17(10-12(14)2-3-15(18)20)16(21)13-5-9-22-11-13/h5,9,11-12,14,19H,1-4,6-8,10H2/t12-,14+/m0/s1 |
| InChIKey | GTNOQPNFEGUXJF-GXTWGEPZSA-N |
| XLogP | 1.58 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |