C17H20N4O4S — CID 56912575
5-(benzylsulfamoylamino)-6-methoxy-1,3-dimethylbenzimidazol-2-one (PubChem CID 56912575) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is 5-(benzylsulfamoylamino)-6-methoxy-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-(benzylsulfamoylamino)-6-methoxy-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 56912575 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-(benzylsulfamoylamino)-6-methoxy-1,3-dimethylbenzimidazol-2-one |
| SMILES | COc1cc2c(cc1NS(=O)(=O)NCc1ccccc1)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H20N4O4S/c1-20-14-9-13(16(25-3)10-15(14)21(2)17(20)22)19-26(23,24)18-11-12-7-5-4-6-8-12/h4-10,18-19H,11H2,1-3H3 |
| InChIKey | OIJUJWVDBRJFMU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |