C18H22N4O4 — CID 56915236
1-[6-(2-hydroxyethylamino)pyrimidin-4-yl]-4-phenoxypiperidine-4-carboxylic acid (PubChem CID 56915236) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-[6-(2-hydroxyethylamino)pyrimidin-4-yl]-4-phenoxypiperidine-4-carboxylic acid.
| Compound Name | 1-[6-(2-hydroxyethylamino)pyrimidin-4-yl]-4-phenoxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56915236 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[6-(2-hydroxyethylamino)pyrimidin-4-yl]-4-phenoxypiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(Oc2ccccc2)CCN(c2cc(NCCO)ncn2)CC1 |
| InChI | InChI=1S/C18H22N4O4/c23-11-8-19-15-12-16(21-13-20-15)22-9-6-18(7-10-22,17(24)25)26-14-4-2-1-3-5-14/h1-5,12-13,23H,6-11H2,(H,24,25)(H,19,20,21) |
| InChIKey | NLRBXHKPRDOIMK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |