C18H23N7 — CID 56915543
4-N-[3-(1H-benzimidazol-2-yl)propyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56915543) has the molecular formula C18H23N7 and a molecular weight of 337.43 g/mol. Its IUPAC name is 4-N-[3-(1H-benzimidazol-2-yl)propyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-[3-(1H-benzimidazol-2-yl)propyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56915543 |
| Molecular Formula | C18H23N7 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 4-N-[3-(1H-benzimidazol-2-yl)propyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Nc1nc2c(c(NCCCc3nc4ccccc4[nH]3)n1)CCNCC2 |
| InChI | InChI=1S/C18H23N7/c19-18-24-13-8-11-20-10-7-12(13)17(25-18)21-9-3-6-16-22-14-4-1-2-5-15(14)23-16/h1-2,4-5,20H,3,6-11H2,(H,22,23)(H3,19,21,24,25) |
| InChIKey | YKJMCYGMFQDHOZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|