C17H20N4O3S — CID 56915753
1-[5-(benzylsulfamoylamino)-1-methylbenzimidazol-2-yl]ethanol (PubChem CID 56915753) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-[5-(benzylsulfamoylamino)-1-methylbenzimidazol-2-yl]ethanol.
| Compound Name | 1-[5-(benzylsulfamoylamino)-1-methylbenzimidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 56915753 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[5-(benzylsulfamoylamino)-1-methylbenzimidazol-2-yl]ethanol |
| SMILES | CC(O)c1nc2cc(NS(=O)(=O)NCc3ccccc3)ccc2n1C |
| InChI | InChI=1S/C17H20N4O3S/c1-12(22)17-19-15-10-14(8-9-16(15)21(17)2)20-25(23,24)18-11-13-6-4-3-5-7-13/h3-10,12,18,20,22H,11H2,1-2H3 |
| InChIKey | MMKITNZIJLZHLQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |