C20H22N4O2 — CID 56915819
N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]-2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide (PubChem CID 56915819) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]-2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide.
| Compound Name | N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]-2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 56915819 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]-2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide |
| SMILES | Cc1ncc2c(c1CNC(=O)CC1NC(=O)c3ccccc31)CCNC2 |
| InChI | InChI=1S/C20H22N4O2/c1-12-17(14-6-7-21-9-13(14)10-22-12)11-23-19(25)8-18-15-4-2-3-5-16(15)20(26)24-18/h2-5,10,18,21H,6-9,11H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | IWDDZMNMMIIOPO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |