About 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine
1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine (PubChem CID 56916128) has the molecular formula C19H30N2O
and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine.
Molecular Properties
| Compound Name | 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine |
| PubChem CID | 56916128 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine |
| SMILES | CN(C)C1CCCN(Cc2ccc3c(c2)CC(C)(C)O3)CC1 |
| InChI | InChI=1S/C19H30N2O/c1-19(2)13-16-12-15(7-8-18(16)22-19)14-21-10-5-6-17(9-11-21)20(3)4/h7-8,12,17H,5-6,9-11,13-14H2,1-4H3 |
| InChIKey | PWAYCEPLFBVWKZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine?
The IUPAC name of 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine (CID 56916128) is 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine.
What is the SMILES notation for 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine?
The canonical SMILES for 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine is CN(C)C1CCCN(Cc2ccc3c(c2)CC(C)(C)O3)CC1.
What is the InChIKey of 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine?
The InChIKey is PWAYCEPLFBVWKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O/c1-19(2)13-16-12-15(7-8-18(16)22-19)14-21-10-5-6-17(9-11-21)20(3)4/h7-8,12,17H,5-6,9-11,13-14H2,1-4H3.
What are the key properties of 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine?
1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine has a molecular weight of 302.46 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N,N-dimethylazepan-4-amine is sourced from PubChem (CID 56916128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).