About 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine
1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine (PubChem CID 97159105) has the molecular formula C21H33N3O
and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine.
Molecular Properties
| Compound Name | 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine |
| PubChem CID | 97159105 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine |
| SMILES | CCN1CCN([C@@H]2CCN(Cc3ccc4c(c3)CC(C)(C)O4)C2)CC1 |
| InChI | InChI=1S/C21H33N3O/c1-4-22-9-11-24(12-10-22)19-7-8-23(16-19)15-17-5-6-20-18(13-17)14-21(2,3)25-20/h5-6,13,19H,4,7-12,14-16H2,1-3H3/t19-/m1/s1 |
| InChIKey | XQKXLOPZIRQYAJ-LJQANCHMSA-N |
| XLogP | 2.61 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine?
The IUPAC name of 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine (CID 97159105) is 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine.
What is the SMILES notation for 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine?
The canonical SMILES for 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine is CCN1CCN([C@@H]2CCN(Cc3ccc4c(c3)CC(C)(C)O4)C2)CC1.
What is the InChIKey of 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine?
The InChIKey is XQKXLOPZIRQYAJ-LJQANCHMSA-N. The full InChI is InChI=1S/C21H33N3O/c1-4-22-9-11-24(12-10-22)19-7-8-23(16-19)15-17-5-6-20-18(13-17)14-21(2,3)25-20/h5-6,13,19H,4,7-12,14-16H2,1-3H3/t19-/m1/s1.
What are the key properties of 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine?
1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine has a molecular weight of 343.51 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-1-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]pyrrolidin-3-yl]-4-ethylpiperazine is sourced from PubChem (CID 97159105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).