C18H23N5OS — CID 56917422
[4-(2-propylsulfanylethylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-pyridin-3-ylmethanone (PubChem CID 56917422) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is [4-(2-propylsulfanylethylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-pyridin-3-ylmethanone.
| Compound Name | [4-(2-propylsulfanylethylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 56917422 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [4-(2-propylsulfanylethylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-pyridin-3-ylmethanone |
| SMILES | CCCSCCNc1ncnc2c1CCN(C(=O)c1cccnc1)C2 |
| InChI | InChI=1S/C18H23N5OS/c1-2-9-25-10-7-20-17-15-5-8-23(12-16(15)21-13-22-17)18(24)14-4-3-6-19-11-14/h3-4,6,11,13H,2,5,7-10,12H2,1H3,(H,20,21,22) |
| InChIKey | RGVKRNFSBQNIRP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|