C18H18N6O2 — CID 56903682
1,2-oxazol-3-yl-[4-(pyridin-3-ylmethylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]methanone (PubChem CID 56903682) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 1,2-oxazol-3-yl-[4-(pyridin-3-ylmethylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]methanone.
| Compound Name | 1,2-oxazol-3-yl-[4-(pyridin-3-ylmethylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]methanone |
|---|---|
| PubChem CID | 56903682 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1,2-oxazol-3-yl-[4-(pyridin-3-ylmethylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]methanone |
| SMILES | O=C(c1ccon1)N1CCc2ncnc(NCc3cccnc3)c2CC1 |
| InChI | InChI=1S/C18H18N6O2/c25-18(16-5-9-26-23-16)24-7-3-14-15(4-8-24)21-12-22-17(14)20-11-13-2-1-6-19-10-13/h1-2,5-6,9-10,12H,3-4,7-8,11H2,(H,20,21,22) |
| InChIKey | ROGOXPJTYACDNM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |