C14H23ClN4O — CID 56917877
[(4aS,8aR)-6-[2-(4-chloropyrazol-1-yl)ethyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-4a-yl]methanol (PubChem CID 56917877) has the molecular formula C14H23ClN4O and a molecular weight of 298.82 g/mol. Its IUPAC name is [(4aS,8aR)-6-[2-(4-chloropyrazol-1-yl)ethyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aR)-6-[2-(4-chloropyrazol-1-yl)ethyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 56917877 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [(4aS,8aR)-6-[2-(4-chloropyrazol-1-yl)ethyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-4a-yl]methanol |
| SMILES | OC[C@]12CCCN[C@@H]1CCN(CCn1cc(Cl)cn1)C2 |
| InChI | InChI=1S/C14H23ClN4O/c15-12-8-17-19(9-12)7-6-18-5-2-13-14(10-18,11-20)3-1-4-16-13/h8-9,13,16,20H,1-7,10-11H2/t13-,14-/m1/s1 |
| InChIKey | JPYSOZLMCZAABE-ZIAGYGMSSA-N |
| XLogP | 0.97 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |