C21H29N3O2S — CID 56918189
N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]pyridine-3-sulfonamide (PubChem CID 56918189) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]pyridine-3-sulfonamide.
| Compound Name | N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 56918189 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]pyridine-3-sulfonamide |
| SMILES | CC(C)Cc1ccc(CN2CCCC(NS(=O)(=O)c3cccnc3)C2)cc1 |
| InChI | InChI=1S/C21H29N3O2S/c1-17(2)13-18-7-9-19(10-8-18)15-24-12-4-5-20(16-24)23-27(25,26)21-6-3-11-22-14-21/h3,6-11,14,17,20,23H,4-5,12-13,15-16H2,1-2H3 |
| InChIKey | RZHSAIUKKPVXHL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |