C22H32N2 — CID 142312090
3-ethylpyridine;1-[[4-(2-methylpropyl)phenyl]methyl]pyrrolidine (PubChem CID 142312090) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 3-ethylpyridine;1-[[4-(2-methylpropyl)phenyl]methyl]pyrrolidine.
| Compound Name | 3-ethylpyridine;1-[[4-(2-methylpropyl)phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 142312090 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 3-ethylpyridine;1-[[4-(2-methylpropyl)phenyl]methyl]pyrrolidine |
| SMILES | CC(C)Cc1ccc(CN2CCCC2)cc1.CCc1cccnc1 |
| InChI | InChI=1S/C15H23N.C7H9N/c1-13(2)11-14-5-7-15(8-6-14)12-16-9-3-4-10-16;1-2-7-4-3-5-8-6-7/h5-8,13H,3-4,9-12H2,1-2H3;3-6H,2H2,1H3 |
| InChIKey | OGPNCZJHDIWSGO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |