About 2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate
2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate (PubChem CID 569192) has the molecular formula C19H15NO4
and a molecular weight of 321.30 g/mol. Its IUPAC name is phenacyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate |
| PubChem CID | 569192 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | phenacyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)OCC(=O)C3=CC=CC=C3 |
| InChI | InChI=1S/C19H15NO4/c1-13-17(18(20-24-13)15-10-6-3-7-11-15)19(22)23-12-16(21)14-8-4-2-5-9-14/h2-11H,12H2,1H3 |
| InChIKey | XHPQLCFYRGYKAK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | 441 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate?
The IUPAC name of 2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate (CID 569192) is phenacyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for 2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate?
The canonical SMILES for 2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate is CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)OCC(=O)C3=CC=CC=C3.
What is the InChIKey of 2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate?
The InChIKey is XHPQLCFYRGYKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO4/c1-13-17(18(20-24-13)15-10-6-3-7-11-15)19(22)23-12-16(21)14-8-4-2-5-9-14/h2-11H,12H2,1H3.
What are the key properties of 2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate?
2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate has a molecular weight of 321.30 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Oxo-2-phenylethyl 5-methyl-3-phenylisoxazole-4-carboxylate is sourced from PubChem (CID 569192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).