C19H21FN2O2 — CID 56919385
3-[3-[2-(4-fluorophenyl)ethyl]piperidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 56919385) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-[3-[2-(4-fluorophenyl)ethyl]piperidine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 3-[3-[2-(4-fluorophenyl)ethyl]piperidine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 56919385 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-[3-[2-(4-fluorophenyl)ethyl]piperidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1ccc[nH]c1=O)N1CCCC(CCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H21FN2O2/c20-16-9-7-14(8-10-16)5-6-15-3-2-12-22(13-15)19(24)17-4-1-11-21-18(17)23/h1,4,7-11,15H,2-3,5-6,12-13H2,(H,21,23) |
| InChIKey | PVBNIFGFWRTNCT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |