C18H23BrN6O — CID 56919567
N-(4-bromophenyl)-4-[6-(dimethylamino)-2-methylpyrimidin-4-yl]piperazine-1-carboxamide (PubChem CID 56919567) has the molecular formula C18H23BrN6O and a molecular weight of 419.33 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[6-(dimethylamino)-2-methylpyrimidin-4-yl]piperazine-1-carboxamide.
| Compound Name | N-(4-bromophenyl)-4-[6-(dimethylamino)-2-methylpyrimidin-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 56919567 |
| Molecular Formula | C18H23BrN6O |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-(4-bromophenyl)-4-[6-(dimethylamino)-2-methylpyrimidin-4-yl]piperazine-1-carboxamide |
| SMILES | Cc1nc(N(C)C)cc(N2CCN(C(=O)Nc3ccc(Br)cc3)CC2)n1 |
| InChI | InChI=1S/C18H23BrN6O/c1-13-20-16(23(2)3)12-17(21-13)24-8-10-25(11-9-24)18(26)22-15-6-4-14(19)5-7-15/h4-7,12H,8-11H2,1-3H3,(H,22,26) |
| InChIKey | DXDHLNTTXVLJSV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |