C16H21N5OS — CID 122340190
[4-[6-(dimethylamino)-2-methylpyrimidin-4-yl]piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 122340190) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is [4-[6-(dimethylamino)-2-methylpyrimidin-4-yl]piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[6-(dimethylamino)-2-methylpyrimidin-4-yl]piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 122340190 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | [4-[6-(dimethylamino)-2-methylpyrimidin-4-yl]piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | Cc1nc(N(C)C)cc(N2CCN(C(=O)c3cccs3)CC2)n1 |
| InChI | InChI=1S/C16H21N5OS/c1-12-17-14(19(2)3)11-15(18-12)20-6-8-21(9-7-20)16(22)13-5-4-10-23-13/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | VXZHIEUQDLBFKQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |