C18H22N4O2S — CID 91770991
[4-[6-(3-hydroxycyclobutyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 91770991) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is [4-[6-(3-hydroxycyclobutyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[6-(3-hydroxycyclobutyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 91770991 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [4-[6-(3-hydroxycyclobutyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | Cc1nc(C2CC(O)C2)cc(N2CCN(C(=O)c3cccs3)CC2)n1 |
| InChI | InChI=1S/C18H22N4O2S/c1-12-19-15(13-9-14(23)10-13)11-17(20-12)21-4-6-22(7-5-21)18(24)16-3-2-8-25-16/h2-3,8,11,13-14,23H,4-7,9-10H2,1H3 |
| InChIKey | LEDLMSZCQZENFP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |