C26H26N6O2S — CID 56922339
N-(5-methyl-2-pyridinyl)-6-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine (PubChem CID 56922339) has the molecular formula C26H26N6O2S and a molecular weight of 486.60 g/mol. Its IUPAC name is N-(5-methyl-2-pyridinyl)-6-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine.
| Compound Name | N-(5-methyl-2-pyridinyl)-6-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 56922339 |
| Molecular Formula | C26H26N6O2S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-(5-methyl-2-pyridinyl)-6-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine |
| SMILES | Cc1ccc(Nc2ccc(N3CCN(S(=O)(=O)c4ccc(-c5ccccc5)cc4)CC3)nn2)nc1 |
| InChI | InChI=1S/C26H26N6O2S/c1-20-7-12-24(27-19-20)28-25-13-14-26(30-29-25)31-15-17-32(18-16-31)35(33,34)23-10-8-22(9-11-23)21-5-3-2-4-6-21/h2-14,19H,15-18H2,1H3,(H,27,28,29) |
| InChIKey | AZOFCEZZMOVPOA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |