C17H14BrNO4 — CID 56926230
7-bromo-6-hydroxy-4-methoxy-N-(4-methylphenyl)-1-benzofuran-5-carboxamide (PubChem CID 56926230) has the molecular formula C17H14BrNO4 and a molecular weight of 376.21 g/mol. Its IUPAC name is 7-bromo-6-hydroxy-4-methoxy-N-(4-methylphenyl)-1-benzofuran-5-carboxamide.
| Compound Name | 7-bromo-6-hydroxy-4-methoxy-N-(4-methylphenyl)-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 56926230 |
| Molecular Formula | C17H14BrNO4 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 7-bromo-6-hydroxy-4-methoxy-N-(4-methylphenyl)-1-benzofuran-5-carboxamide |
| SMILES | COc1c(C(=O)Nc2ccc(C)cc2)c(O)c(Br)c2occc12 |
| InChI | InChI=1S/C17H14BrNO4/c1-9-3-5-10(6-4-9)19-17(21)12-14(20)13(18)16-11(7-8-23-16)15(12)22-2/h3-8,20H,1-2H3,(H,19,21) |
| InChIKey | IQLCCFPTRTTZRW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |