C18H24N6S — CID 56927213
7-[(4-ethylpiperazin-1-yl)methyl]-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 56927213) has the molecular formula C18H24N6S and a molecular weight of 356.50 g/mol. Its IUPAC name is 7-[(4-ethylpiperazin-1-yl)methyl]-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 7-[(4-ethylpiperazin-1-yl)methyl]-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 56927213 |
| Molecular Formula | C18H24N6S |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 7-[(4-ethylpiperazin-1-yl)methyl]-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CCN1CCN(Cc2nc3sc4c(c3c3nncn23)CCCC4)CC1 |
| InChI | InChI=1S/C18H24N6S/c1-2-22-7-9-23(10-8-22)11-15-20-18-16(17-21-19-12-24(15)17)13-5-3-4-6-14(13)25-18/h12H,2-11H2,1H3 |
| InChIKey | ZNSGUJJQAFBRIU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |