About 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate
2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate (PubChem CID 56927696) has the molecular formula C10H24N4O4S
and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate.
Molecular Properties
| Compound Name | 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate |
| PubChem CID | 56927696 |
| Molecular Formula | C10H24N4O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate |
| SMILES | NC(N)=NCCN1CCCCCCC1.O=S(=O)([O-])[O-].[H+].[H+] |
| InChI | InChI=1S/C10H22N4.H2O4S/c11-10(12)13-6-9-14-7-4-2-1-3-5-8-14;1-5(2,3)4/h1-9H2,(H4,11,12,13);(H2,1,2,3,4) |
| InChIKey | YUFWAVFNITUSHI-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate?
The IUPAC name of 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate (CID 56927696) is 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate.
What is the SMILES notation for 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate?
The canonical SMILES for 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate is NC(N)=NCCN1CCCCCCC1.O=S(=O)([O-])[O-].[H+].[H+].
What is the InChIKey of 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate?
The InChIKey is YUFWAVFNITUSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4.H2O4S/c11-10(12)13-6-9-14-7-4-2-1-3-5-8-14;1-5(2,3)4/h1-9H2,(H4,11,12,13);(H2,1,2,3,4).
What are the key properties of 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate?
2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate has a molecular weight of 296.39 g/mol, XLogP of -0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(azocan-1-yl)ethyl]guanidine;hydron;sulfate is sourced from PubChem (CID 56927696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).