C19H15BrN2O4S — CID 56928023
4-bromo-N-[1,4-dioxo-3-(prop-2-enylamino)naphthalen-2-yl]benzenesulfonamide (PubChem CID 56928023) has the molecular formula C19H15BrN2O4S and a molecular weight of 447.31 g/mol. Its IUPAC name is 4-bromo-N-[1,4-dioxo-3-(prop-2-enylamino)naphthalen-2-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[1,4-dioxo-3-(prop-2-enylamino)naphthalen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 56928023 |
| Molecular Formula | C19H15BrN2O4S |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | 4-bromo-N-[1,4-dioxo-3-(prop-2-enylamino)naphthalen-2-yl]benzenesulfonamide |
| SMILES | C=CCNC1=C(NS(=O)(=O)c2ccc(Br)cc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15BrN2O4S/c1-2-11-21-16-17(19(24)15-6-4-3-5-14(15)18(16)23)22-27(25,26)13-9-7-12(20)8-10-13/h2-10,21-22H,1,11H2 |
| InChIKey | ULXQUOBKEGSMPQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|