C16H10BrNO4S — CID 56973478
4-bromo-N-(1,4-dioxonaphthalen-2-yl)benzenesulfonamide (PubChem CID 56973478) has the molecular formula C16H10BrNO4S and a molecular weight of 392.23 g/mol. Its IUPAC name is 4-bromo-N-(1,4-dioxonaphthalen-2-yl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(1,4-dioxonaphthalen-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 56973478 |
| Molecular Formula | C16H10BrNO4S |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 390.95 |
| IUPAC Name | 4-bromo-N-(1,4-dioxonaphthalen-2-yl)benzenesulfonamide |
| SMILES | O=C1C=C(NS(=O)(=O)c2ccc(Br)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H10BrNO4S/c17-10-5-7-11(8-6-10)23(21,22)18-14-9-15(19)12-3-1-2-4-13(12)16(14)20/h1-9,18H |
| InChIKey | LXCAXJJUYAWUQJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|