C22H14BrNO4S — CID 56642993
4-bromo-N-(1,4-dioxo-3-phenylnaphthalen-2-yl)benzenesulfonamide (PubChem CID 56642993) has the molecular formula C22H14BrNO4S and a molecular weight of 468.33 g/mol. Its IUPAC name is 4-bromo-N-(1,4-dioxo-3-phenylnaphthalen-2-yl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(1,4-dioxo-3-phenylnaphthalen-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 56642993 |
| Molecular Formula | C22H14BrNO4S |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | 4-bromo-N-(1,4-dioxo-3-phenylnaphthalen-2-yl)benzenesulfonamide |
| SMILES | O=C1C(NS(=O)(=O)c2ccc(Br)cc2)=C(c2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H14BrNO4S/c23-15-10-12-16(13-11-15)29(27,28)24-20-19(14-6-2-1-3-7-14)21(25)17-8-4-5-9-18(17)22(20)26/h1-13,24H |
| InChIKey | MZWMALPGBVYUTB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|