C22H27N3O5S — CID 56928733
butyl N-[2-ethyl-4-(2-oxo-4-phenylimidazolidin-1-yl)sulfonylphenyl]carbamate (PubChem CID 56928733) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is butyl N-[2-ethyl-4-(2-oxo-4-phenylimidazolidin-1-yl)sulfonylphenyl]carbamate.
| Compound Name | butyl N-[2-ethyl-4-(2-oxo-4-phenylimidazolidin-1-yl)sulfonylphenyl]carbamate |
|---|---|
| PubChem CID | 56928733 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | butyl N-[2-ethyl-4-(2-oxo-4-phenylimidazolidin-1-yl)sulfonylphenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(S(=O)(=O)N2CC(c3ccccc3)NC2=O)cc1CC |
| InChI | InChI=1S/C22H27N3O5S/c1-3-5-13-30-22(27)24-19-12-11-18(14-16(19)4-2)31(28,29)25-15-20(23-21(25)26)17-9-7-6-8-10-17/h6-12,14,20H,3-5,13,15H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | TTXMTWQCEVUMIA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|