C26H34N4O — CID 56929606
2-[4-(3-methylphenyl)piperazin-1-yl]-N-[(4-phenyl-5-propyl-1,3-oxazol-2-yl)methyl]ethanamine (PubChem CID 56929606) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-[4-(3-methylphenyl)piperazin-1-yl]-N-[(4-phenyl-5-propyl-1,3-oxazol-2-yl)methyl]ethanamine.
| Compound Name | 2-[4-(3-methylphenyl)piperazin-1-yl]-N-[(4-phenyl-5-propyl-1,3-oxazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 56929606 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 2-[4-(3-methylphenyl)piperazin-1-yl]-N-[(4-phenyl-5-propyl-1,3-oxazol-2-yl)methyl]ethanamine |
| SMILES | CCCc1oc(CNCCN2CCN(c3cccc(C)c3)CC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C26H34N4O/c1-3-8-24-26(22-10-5-4-6-11-22)28-25(31-24)20-27-13-14-29-15-17-30(18-16-29)23-12-7-9-21(2)19-23/h4-7,9-12,19,27H,3,8,13-18,20H2,1-2H3 |
| InChIKey | OEEKBSNXILJSGP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|