C26H33FN4O — CID 56928320
3-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(4-phenyl-5-propyl-1,3-oxazol-2-yl)methyl]propan-1-amine (PubChem CID 56928320) has the molecular formula C26H33FN4O and a molecular weight of 436.58 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(4-phenyl-5-propyl-1,3-oxazol-2-yl)methyl]propan-1-amine.
| Compound Name | 3-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(4-phenyl-5-propyl-1,3-oxazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 56928320 |
| Molecular Formula | C26H33FN4O |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 3-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(4-phenyl-5-propyl-1,3-oxazol-2-yl)methyl]propan-1-amine |
| SMILES | CCCc1oc(CNCCCN2CCN(c3ccc(F)cc3)CC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C26H33FN4O/c1-2-7-24-26(21-8-4-3-5-9-21)29-25(32-24)20-28-14-6-15-30-16-18-31(19-17-30)23-12-10-22(27)11-13-23/h3-5,8-13,28H,2,6-7,14-20H2,1H3 |
| InChIKey | HCVWKKRMSYDBHN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|