C16H14O5S — CID 56930675
3-benzyl-7-methoxy-2,2-dioxo-1,2λ6-benzoxathiin-4-one (PubChem CID 56930675) has the molecular formula C16H14O5S and a molecular weight of 318.35 g/mol. Its IUPAC name is 3-benzyl-7-methoxy-2,2-dioxo-1,2λ6-benzoxathiin-4-one.
| Compound Name | 3-benzyl-7-methoxy-2,2-dioxo-1,2λ6-benzoxathiin-4-one |
|---|---|
| PubChem CID | 56930675 |
| Molecular Formula | C16H14O5S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-benzyl-7-methoxy-2,2-dioxo-1,2λ6-benzoxathiin-4-one |
| SMILES | COc1ccc2c(c1)OS(=O)(=O)C(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C16H14O5S/c1-20-12-7-8-13-14(10-12)21-22(18,19)15(16(13)17)9-11-5-3-2-4-6-11/h2-8,10,15H,9H2,1H3 |
| InChIKey | MRIKWPHVUFWAIK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|