C23H25N5O2 — CID 56934838
3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]-1-propylpyrazole-5-carbohydrazide (PubChem CID 56934838) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]-1-propylpyrazole-5-carbohydrazide.
| Compound Name | 3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]-1-propylpyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 56934838 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]-1-propylpyrazole-5-carbohydrazide |
| SMILES | CCCn1nc(-c2cn(Cc3ccc(OC)cc3)c3ccccc23)cc1C(=O)NN |
| InChI | InChI=1S/C23H25N5O2/c1-3-12-28-22(23(29)25-24)13-20(26-28)19-15-27(21-7-5-4-6-18(19)21)14-16-8-10-17(30-2)11-9-16/h4-11,13,15H,3,12,14,24H2,1-2H3,(H,25,29) |
| InChIKey | TUALWTWAYSAEKM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|