C25H22IN3S — CID 56935257
4-[[4-[(4-iodophenyl)-quinolin-8-ylmethylidene]piperidin-1-yl]methyl]-1,3-thiazole (PubChem CID 56935257) has the molecular formula C25H22IN3S and a molecular weight of 523.44 g/mol. Its IUPAC name is 4-[[4-[(4-iodophenyl)-quinolin-8-ylmethylidene]piperidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 4-[[4-[(4-iodophenyl)-quinolin-8-ylmethylidene]piperidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 56935257 |
| Molecular Formula | C25H22IN3S |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | 4-[[4-[(4-iodophenyl)-quinolin-8-ylmethylidene]piperidin-1-yl]methyl]-1,3-thiazole |
| SMILES | Ic1ccc(C(=C2CCN(Cc3cscn3)CC2)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C25H22IN3S/c26-21-8-6-18(7-9-21)24(23-5-1-3-20-4-2-12-27-25(20)23)19-10-13-29(14-11-19)15-22-16-30-17-28-22/h1-9,12,16-17H,10-11,13-15H2 |
| InChIKey | NRGJCXRXTORYLX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|