C31H31F3N4O4S — CID 56935387
N-methyl-4-[quinolin-8-yl-[1-(1,3-thiazol-4-ylmethyl)piperidin-4-ylidene]methyl]-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 56935387) has the molecular formula C31H31F3N4O4S and a molecular weight of 616.70 g/mol. Its IUPAC name is N-methyl-4-[quinolin-8-yl-[1-(1,3-thiazol-4-ylmethyl)piperidin-4-ylidene]methyl]-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-methyl-4-[quinolin-8-yl-[1-(1,3-thiazol-4-ylmethyl)piperidin-4-ylidene]methyl]-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 56935387 |
| Molecular Formula | C31H31F3N4O4S |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | N-methyl-4-[quinolin-8-yl-[1-(1,3-thiazol-4-ylmethyl)piperidin-4-ylidene]methyl]-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[2H]C([2H])(O)C([2H])([2H])N(C)C(=O)c1ccc(C(=C2CCN(Cc3cscn3)CC2)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C29H30N4O2S.C2HF3O2/c1-32(16-17-34)29(35)24-9-7-21(8-10-24)27(26-6-2-4-23-5-3-13-30-28(23)26)22-11-14-33(15-12-22)18-25-19-36-20-31-25;3-2(4,5)1(6)7/h2-10,13,19-20,34H,11-12,14-18H2,1H3;(H,6,7)/i16D2,17D2; |
| InChIKey | WTTVGICKHPTUNH-ZBLPOJTCSA-N |
| XLogP | 5.49 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |