C18H9Cl3N4O3 — CID 56935506
6-nitro-2-[3-[(3,5,6-trichloro-2-pyridinyl)oxy]phenyl]-1H-benzimidazole (PubChem CID 56935506) has the molecular formula C18H9Cl3N4O3 and a molecular weight of 435.65 g/mol. Its IUPAC name is 6-nitro-2-[3-[(3,5,6-trichloro-2-pyridinyl)oxy]phenyl]-1H-benzimidazole.
| Compound Name | 6-nitro-2-[3-[(3,5,6-trichloro-2-pyridinyl)oxy]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 56935506 |
| Molecular Formula | C18H9Cl3N4O3 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | 6-nitro-2-[3-[(3,5,6-trichloro-2-pyridinyl)oxy]phenyl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3cccc(Oc4nc(Cl)c(Cl)cc4Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C18H9Cl3N4O3/c19-12-8-13(20)18(24-16(12)21)28-11-3-1-2-9(6-11)17-22-14-5-4-10(25(26)27)7-15(14)23-17/h1-8H,(H,22,23) |
| InChIKey | IHMJXVSXPQVEDW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|