C27H26F2N6O3S — CID 56941461
N-[5-amino-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]-2-[1-[(3,5-difluorophenyl)methyl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 56941461) has the molecular formula C27H26F2N6O3S and a molecular weight of 552.61 g/mol. Its IUPAC name is N-[5-amino-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]-2-[1-[(3,5-difluorophenyl)methyl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[5-amino-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]-2-[1-[(3,5-difluorophenyl)methyl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 56941461 |
| Molecular Formula | C27H26F2N6O3S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | N-[5-amino-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]-2-[1-[(3,5-difluorophenyl)methyl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | Nc1ccc(N2CCC3(CC2)OCCO3)c(NC(=O)c2csc(-c3cnn(Cc4cc(F)cc(F)c4)c3)n2)c1 |
| InChI | InChI=1S/C27H26F2N6O3S/c28-19-9-17(10-20(29)11-19)14-35-15-18(13-31-35)26-33-23(16-39-26)25(36)32-22-12-21(30)1-2-24(22)34-5-3-27(4-6-34)37-7-8-38-27/h1-2,9-13,15-16H,3-8,14,30H2,(H,32,36) |
| InChIKey | QOOKZJCZJVRSGZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|