C20H24ClN7O2 — CID 56942785
1-[4-(2-amino-8-propyl-7H-purin-6-yl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone (PubChem CID 56942785) has the molecular formula C20H24ClN7O2 and a molecular weight of 429.91 g/mol. Its IUPAC name is 1-[4-(2-amino-8-propyl-7H-purin-6-yl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone.
| Compound Name | 1-[4-(2-amino-8-propyl-7H-purin-6-yl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
|---|---|
| PubChem CID | 56942785 |
| Molecular Formula | C20H24ClN7O2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-[4-(2-amino-8-propyl-7H-purin-6-yl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
| SMILES | CCCc1nc2nc(N)nc(N3CCN(C(=O)COc4ccc(Cl)cc4)CC3)c2[nH]1 |
| InChI | InChI=1S/C20H24ClN7O2/c1-2-3-15-23-17-18(24-15)25-20(22)26-19(17)28-10-8-27(9-11-28)16(29)12-30-14-6-4-13(21)5-7-14/h4-7H,2-3,8-12H2,1H3,(H3,22,23,24,25,26) |
| InChIKey | HYVRVCOMRAOJDK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |