C21H20ClN7O2S — CID 66802089
1-[4-(2-amino-8-thiophen-2-yl-7H-purin-6-yl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone (PubChem CID 66802089) has the molecular formula C21H20ClN7O2S and a molecular weight of 469.96 g/mol. Its IUPAC name is 1-[4-(2-amino-8-thiophen-2-yl-7H-purin-6-yl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone.
| Compound Name | 1-[4-(2-amino-8-thiophen-2-yl-7H-purin-6-yl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
|---|---|
| PubChem CID | 66802089 |
| Molecular Formula | C21H20ClN7O2S |
| Molecular Weight | 469.96 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 1-[4-(2-amino-8-thiophen-2-yl-7H-purin-6-yl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
| SMILES | Nc1nc(N2CCN(C(=O)COc3ccc(Cl)cc3)CC2)c2[nH]c(-c3cccs3)nc2n1 |
| InChI | InChI=1S/C21H20ClN7O2S/c22-13-3-5-14(6-4-13)31-12-16(30)28-7-9-29(10-8-28)20-17-19(26-21(23)27-20)25-18(24-17)15-2-1-11-32-15/h1-6,11H,7-10,12H2,(H3,23,24,25,26,27) |
| InChIKey | YRPJCOVWXQGLIN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.96 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |